C27H24N2O9 — CID 91046725
[(4aR,5S,5aR,12aS)-2-carbamoyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] 2-(4-aminophenyl)acetate (PubChem CID 91046725) has the molecular formula C27H24N2O9 and a molecular weight of 520.49 g/mol. Its IUPAC name is [(4aR,5S,5aR,12aS)-2-carbamoyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] 2-(4-aminophenyl)acetate.
| Compound Name | [(4aR,5S,5aR,12aS)-2-carbamoyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] 2-(4-aminophenyl)acetate |
|---|---|
| PubChem CID | 91046725 |
| Molecular Formula | C27H24N2O9 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | [(4aR,5S,5aR,12aS)-2-carbamoyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] 2-(4-aminophenyl)acetate |
| SMILES | NC(=O)C1C(=O)C[C@@H]2[C@@H](OC(=O)Cc3ccc(N)cc3)[C@@H]3Cc4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C27H24N2O9/c28-13-6-4-11(5-7-13)8-18(32)38-23-14-9-12-2-1-3-16(30)19(12)22(33)20(14)24(34)27(37)15(23)10-17(31)21(25(27)35)26(29)36/h1-7,14-15,20-21,23,30,37H,8-10,28H2,(H2,29,36)/t14-,15-,20?,21?,23+,27+/m1/s1 |
| InChIKey | VKJFEIUIESVGDJ-AXNIWHEVSA-N |
| XLogP | -0.33 |
| TPSA | 204.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|