C20H17NO8 — CID 91136567
(4aS,5R,5aR,12aR)-5,10,12a-trihydroxy-6-methylidene-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91136567) has the molecular formula C20H17NO8 and a molecular weight of 399.36 g/mol. Its IUPAC name is (4aS,5R,5aR,12aR)-5,10,12a-trihydroxy-6-methylidene-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5R,5aR,12aR)-5,10,12a-trihydroxy-6-methylidene-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91136567 |
| Molecular Formula | C20H17NO8 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | (4aS,5R,5aR,12aR)-5,10,12a-trihydroxy-6-methylidene-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C=C1c2cccc(O)c2C(=O)C2C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(=O)C[C@H]3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C20H17NO8/c1-6-7-3-2-4-9(22)12(7)16(25)14-11(6)15(24)8-5-10(23)13(19(21)28)17(26)20(8,29)18(14)27/h2-4,8,11,13-15,22,24,29H,1,5H2,(H2,21,28)/t8-,11-,13?,14?,15-,20-/m0/s1 |
| InChIKey | GZAYVGPSYGSYFR-REGRDKGYSA-N |
| XLogP | -1.23 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|