C27H29NO9 — CID 90752750
(4aR,5aR,12aS)-7-(2-cyclopentyl-2-oxoethyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90752750) has the molecular formula C27H29NO9 and a molecular weight of 511.53 g/mol. Its IUPAC name is (4aR,5aR,12aS)-7-(2-cyclopentyl-2-oxoethyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aR,12aS)-7-(2-cyclopentyl-2-oxoethyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90752750 |
| Molecular Formula | C27H29NO9 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | (4aR,5aR,12aS)-7-(2-cyclopentyl-2-oxoethyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC1c2c(CC(=O)C3CCCC3)ccc(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C(O)[C@@H]21 |
| InChI | InChI=1S/C27H29NO9/c1-10-17-12(8-15(30)11-4-2-3-5-11)6-7-14(29)19(17)23(33)21-18(10)22(32)13-9-16(31)20(26(28)36)24(34)27(13,37)25(21)35/h6-7,10-11,13,18,20-22,29,32,37H,2-5,8-9H2,1H3,(H2,28,36)/t10?,13-,18-,20?,21?,22?,27-/m1/s1 |
| InChIKey | QPPSIMFOZSTMKR-VTYMSBJVSA-N |
| XLogP | 0.16 |
| TPSA | 189.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|