C28H27N3O11S — CID 90911239
(4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-9-[(4-methylphenyl)sulfonylcarbamoylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90911239) has the molecular formula C28H27N3O11S and a molecular weight of 613.60 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-9-[(4-methylphenyl)sulfonylcarbamoylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-9-[(4-methylphenyl)sulfonylcarbamoylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90911239 |
| Molecular Formula | C28H27N3O11S |
| Molecular Weight | 613.60 g/mol |
| Exact Mass | 613.14 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-9-[(4-methylphenyl)sulfonylcarbamoylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)C[C@@H]4[C@@H](O)[C@@H]2[C@H]3C)cc1 |
| InChI | InChI=1S/C28H27N3O11S/c1-10-3-5-12(6-4-10)43(41,42)31-27(39)30-15-8-7-13-11(2)17-20(23(35)18(13)22(15)34)25(37)28(40)14(21(17)33)9-16(32)19(24(28)36)26(29)38/h3-8,11,14,17,19-21,33-34,40H,9H2,1-2H3,(H2,29,38)(H2,30,31,39)/t11-,14+,17+,19?,20?,21+,28+/m0/s1 |
| InChIKey | XZXZNLWMRWTISM-HLLGIHAKSA-N |
| XLogP | -0.32 |
| TPSA | 247.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.60 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|