C28H26ClN3O9 — CID 91285788
(4aR,5S,5aR,6R,12aS)-9-[[4-(chloromethyl)phenyl]carbamoylamino]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91285788) has the molecular formula C28H26ClN3O9 and a molecular weight of 583.98 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-9-[[4-(chloromethyl)phenyl]carbamoylamino]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-9-[[4-(chloromethyl)phenyl]carbamoylamino]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91285788 |
| Molecular Formula | C28H26ClN3O9 |
| Molecular Weight | 583.98 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-9-[[4-(chloromethyl)phenyl]carbamoylamino]-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(NC(=O)Nc3ccc(CCl)cc3)c(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C28H26ClN3O9/c1-10-13-6-7-15(32-27(40)31-12-4-2-11(9-29)3-5-12)22(35)18(13)23(36)20-17(10)21(34)14-8-16(33)19(26(30)39)24(37)28(14,41)25(20)38/h2-7,10,14,17,19-21,34-35,41H,8-9H2,1H3,(H2,30,39)(H2,31,32,40)/t10-,14+,17+,19?,20?,21+,28+/m0/s1 |
| InChIKey | WWQCEVHTLKIBAC-FKQXJDBTSA-N |
| XLogP | 1.24 |
| TPSA | 213.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.98 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|