C29H25N3O8S — CID 91316114
(4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-9-[(5-phenyl-1,3-thiazol-2-yl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91316114) has the molecular formula C29H25N3O8S and a molecular weight of 575.60 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-9-[(5-phenyl-1,3-thiazol-2-yl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-9-[(5-phenyl-1,3-thiazol-2-yl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91316114 |
| Molecular Formula | C29H25N3O8S |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-9-[(5-phenyl-1,3-thiazol-2-yl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(Nc3ncc(-c4ccccc4)s3)c(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C29H25N3O8S/c1-11-13-7-8-15(32-28-31-10-17(41-28)12-5-3-2-4-6-12)23(35)19(13)24(36)21-18(11)22(34)14-9-16(33)20(27(30)39)25(37)29(14,40)26(21)38/h2-8,10-11,14,18,20-22,34-35,40H,9H2,1H3,(H2,30,39)(H,31,32)/t11-,14+,18+,20?,21?,22+,29+/m0/s1 |
| InChIKey | CDXORPWFNLLWIN-PAGNHHAHSA-N |
| XLogP | 1.73 |
| TPSA | 196.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|