C26H25N3O10S — CID 90858940
ethyl 2-[[(5R,5aR,6S,6aR,10aS)-9-carbamoyl-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 90858940) has the molecular formula C26H25N3O10S and a molecular weight of 571.56 g/mol. Its IUPAC name is ethyl 2-[[(5R,5aR,6S,6aR,10aS)-9-carbamoyl-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(5R,5aR,6S,6aR,10aS)-9-carbamoyl-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 90858940 |
| Molecular Formula | C26H25N3O10S |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | ethyl 2-[[(5R,5aR,6S,6aR,10aS)-9-carbamoyl-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2ccc3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)C[C@@H]4[C@@H](O)[C@@H]2[C@H]3C)n1 |
| InChI | InChI=1S/C26H25N3O10S/c1-3-39-24(37)12-7-40-25(29-12)28-11-5-4-9-8(2)14-17(20(33)15(9)19(11)32)22(35)26(38)10(18(14)31)6-13(30)16(21(26)34)23(27)36/h4-5,7-8,10,14,16-18,31-32,38H,3,6H2,1-2H3,(H2,27,36)(H,28,29)/t8-,10+,14+,16?,17?,18+,26+/m0/s1 |
| InChIKey | ONQMAIDRGXNXOX-MMUYYYFWSA-N |
| XLogP | 0.24 |
| TPSA | 223.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|