C23H26N2O8 — CID 91236176
(4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6,9-dimethyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91236176) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6,9-dimethyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6,9-dimethyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91236176 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6,9-dimethyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | Cc1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)[C@@H]3[C@@H](O)[C@@H]1[C@H]2C |
| InChI | InChI=1S/C23H26N2O8/c1-7-5-6-9-8(2)10-12(17(27)11(9)16(7)26)20(30)23(33)14(18(10)28)15(25(3)4)19(29)13(21(23)31)22(24)32/h5-6,8,10,12-15,18,26,28,33H,1-4H3,(H2,24,32)/t8-,10+,12?,13?,14+,15?,18-,23-/m0/s1 |
| InChIKey | LOHRWFPIKAFPQC-XAJNEVPTSA-N |
| XLogP | -1.29 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|