C32H38N2O8 — CID 91243986
(4R,4aS,5R,5aS,6S,12aR)-9-(2-adamantyl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91243986) has the molecular formula C32H38N2O8 and a molecular weight of 578.66 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,6S,12aR)-9-(2-adamantyl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,6S,12aR)-9-(2-adamantyl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91243986 |
| Molecular Formula | C32H38N2O8 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | (4R,4aS,5R,5aS,6S,12aR)-9-(2-adamantyl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@@H]1c2ccc(C3C4CC5CC(C4)CC3C5)c(O)c2C(=O)C2C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]3[C@H](O)[C@H]21 |
| InChI | InChI=1S/C32H38N2O8/c1-11-16-4-5-17(19-14-7-12-6-13(9-14)10-15(19)8-12)25(35)20(16)26(36)21-18(11)27(37)23-24(34(2)3)28(38)22(31(33)41)30(40)32(23,42)29(21)39/h4-5,11-15,18-19,21-24,27,35,37,42H,6-10H2,1-3H3,(H2,33,41)/t11-,12?,13?,14?,15?,18+,19?,21?,22?,23+,24-,27-,32-/m1/s1 |
| InChIKey | VSYHSOSSVDDLFO-JPBDRDQNSA-N |
| XLogP | 0.94 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|