C27H35N3O8 — CID 91422328
(4S,5S,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-9-[(2-methylpropylamino)methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91422328) has the molecular formula C27H35N3O8 and a molecular weight of 529.59 g/mol. Its IUPAC name is (4S,5S,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-9-[(2-methylpropylamino)methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-9-[(2-methylpropylamino)methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91422328 |
| Molecular Formula | C27H35N3O8 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (4S,5S,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-9-[(2-methylpropylamino)methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)CNCc1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C1C2C |
| InChI | InChI=1S/C27H35N3O8/c1-10(2)8-29-9-12-6-7-13-11(3)14-16(21(32)15(13)20(12)31)24(35)27(38)18(22(14)33)19(30(4)5)23(34)17(25(27)36)26(28)37/h6-7,10-11,14,16-19,22,29,31,33,38H,8-9H2,1-5H3,(H2,28,37)/t11?,14?,16?,17?,18?,19-,22?,27-/m0/s1 |
| InChIKey | PPIDMQAJAHPXIK-NLHSYLGISA-N |
| XLogP | -0.86 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|