C29H34N4O8 — CID 123452169
(4S,4aR,5S,5aR,6R)-9-[(4-cyanopiperidin-1-yl)methyl]-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123452169) has the molecular formula C29H34N4O8 and a molecular weight of 566.61 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R)-9-[(4-cyanopiperidin-1-yl)methyl]-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R)-9-[(4-cyanopiperidin-1-yl)methyl]-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123452169 |
| Molecular Formula | C29H34N4O8 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | (4S,4aR,5S,5aR,6R)-9-[(4-cyanopiperidin-1-yl)methyl]-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(CN3CCC(C#N)CC3)c(O)c2C(=O)C2C(=O)C3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C29H34N4O8/c1-12-15-5-4-14(11-33-8-6-13(10-30)7-9-33)22(34)17(15)23(35)18-16(12)24(36)20-21(32(2)3)25(37)19(28(31)40)27(39)29(20,41)26(18)38/h4-5,12-13,16,18-21,24,34,36,41H,6-9,11H2,1-3H3,(H2,31,40)/t12-,16+,18?,19?,20+,21-,24-,29?/m0/s1 |
| InChIKey | IUPPRTMLEHNCKJ-YNMMQKMCSA-N |
| XLogP | -0.87 |
| TPSA | 202.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|