C23H24BrN3O9 — CID 90964917
N-[(5R,5aR,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyl bromide (PubChem CID 90964917) has the molecular formula C23H24BrN3O9 and a molecular weight of 566.36 g/mol. Its IUPAC name is N-[(5R,5aR,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyl bromide.
| Compound Name | N-[(5R,5aR,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyl bromide |
|---|---|
| PubChem CID | 90964917 |
| Molecular Formula | C23H24BrN3O9 |
| Molecular Weight | 566.36 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | N-[(5R,5aR,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyl bromide |
| SMILES | C[C@H]1c2ccc(NC(=O)Br)c(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C23H24BrN3O9/c1-6-7-4-5-8(26-22(24)35)15(28)10(7)16(29)11-9(6)17(30)13-14(27(2)3)18(31)12(21(25)34)20(33)23(13,36)19(11)32/h4-6,9,11-14,17,28,30,36H,1-3H3,(H2,25,34)(H,26,35)/t6-,9+,11?,12?,13+,14-,17-,23-/m0/s1 |
| InChIKey | ZSXBMGIIAMALOV-ONUHUSOVSA-N |
| XLogP | -0.67 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.36 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|