C27H34N4O9 — CID 123408176
9-(tert-butylcarbamoylamino)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123408176) has the molecular formula C27H34N4O9 and a molecular weight of 558.59 g/mol. Its IUPAC name is 9-(tert-butylcarbamoylamino)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-(tert-butylcarbamoylamino)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123408176 |
| Molecular Formula | C27H34N4O9 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 9-(tert-butylcarbamoylamino)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC1c2ccc(NC(=O)NC(C)(C)C)c(O)c2C(=O)C2C(=O)C3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C27H34N4O9/c1-9-10-7-8-11(29-25(39)30-26(2,3)4)18(32)13(10)19(33)14-12(9)20(34)16-17(31(5)6)21(35)15(24(28)38)23(37)27(16,40)22(14)36/h7-9,12,14-17,20,32,34,40H,1-6H3,(H2,28,38)(H2,29,30,39) |
| InChIKey | XFYSCGIDGSKTNX-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 216.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|