C27H32N4O11 — CID 57183365
2-[[2-[[(7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]amino]-2-oxoethyl]amino]propanoic acid (PubChem CID 57183365) has the molecular formula C27H32N4O11 and a molecular weight of 588.57 g/mol. Its IUPAC name is 2-[[2-[[(7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]amino]-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[(7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]amino]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 57183365 |
| Molecular Formula | C27H32N4O11 |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 2-[[2-[[(7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]amino]-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(NCC(=O)Nc1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C1C2C)C(=O)O |
| InChI | InChI=1S/C27H32N4O11/c1-8-10-5-6-11(30-12(32)7-29-9(2)26(40)41)19(33)14(10)20(34)15-13(8)21(35)17-18(31(3)4)22(36)16(25(28)39)24(38)27(17,42)23(15)37/h5-6,8-9,13,15-18,21,29,33,35,42H,7H2,1-4H3,(H2,28,39)(H,30,32)(H,40,41)/t8?,9?,13?,15?,16?,17?,18-,21?,27-/m0/s1 |
| InChIKey | WHKMHWTYXOQUPW-VMMSVCGJSA-N |
| XLogP | -2.60 |
| TPSA | 253.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|