C26H29N3O10 — CID 123703746
prop-2-enyl N-[9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamate (PubChem CID 123703746) has the molecular formula C26H29N3O10 and a molecular weight of 543.53 g/mol. Its IUPAC name is prop-2-enyl N-[9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamate |
|---|---|
| PubChem CID | 123703746 |
| Molecular Formula | C26H29N3O10 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | prop-2-enyl N-[9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1ccc2c(c1O)C(=O)C1C(=O)C3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C3C(O)C1C2C |
| InChI | InChI=1S/C26H29N3O10/c1-5-8-39-25(37)28-11-7-6-10-9(2)12-14(19(31)13(10)18(11)30)22(34)26(38)16(20(12)32)17(29(3)4)21(33)15(23(26)35)24(27)36/h5-7,9,12,14-17,20,30,32,38H,1,8H2,2-4H3,(H2,27,36)(H,28,37) |
| InChIKey | LZNOLQXCPRIKSH-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 213.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|