C28H27FN2O8 — CID 91421730
(4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-9-(4-fluorophenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91421730) has the molecular formula C28H27FN2O8 and a molecular weight of 538.53 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-9-(4-fluorophenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-9-(4-fluorophenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91421730 |
| Molecular Formula | C28H27FN2O8 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-9-(4-fluorophenyl)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@@H]1c2ccc(-c3ccc(F)cc3)c(O)c2C(=O)C2C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]3[C@H](O)[C@H]21 |
| InChI | InChI=1S/C28H27FN2O8/c1-10-13-8-9-14(11-4-6-12(29)7-5-11)21(32)16(13)22(33)17-15(10)23(34)19-20(31(2)3)24(35)18(27(30)38)26(37)28(19,39)25(17)36/h4-10,15,17-20,23,32,34,39H,1-3H3,(H2,30,38)/t10-,15+,17?,18?,19+,20-,23-,28-/m1/s1 |
| InChIKey | LAXOUWRTHGKTRI-QHPHMYCMSA-N |
| XLogP | 0.20 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|