C30H30N2O9 — CID 123727375
9-(4-acetylphenyl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123727375) has the molecular formula C30H30N2O9 and a molecular weight of 562.58 g/mol. Its IUPAC name is 9-(4-acetylphenyl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-(4-acetylphenyl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123727375 |
| Molecular Formula | C30H30N2O9 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 9-(4-acetylphenyl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(=O)c1ccc(-c2ccc3c(c2O)C(=O)C2C(=O)C4(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C4C(O)C2C3C)cc1 |
| InChI | InChI=1S/C30H30N2O9/c1-11-15-9-10-16(14-7-5-13(6-8-14)12(2)33)23(34)18(15)24(35)19-17(11)25(36)21-22(32(3)4)26(37)20(29(31)40)28(39)30(21,41)27(19)38/h5-11,17,19-22,25,34,36,41H,1-4H3,(H2,31,40) |
| InChIKey | GGCMDGOAFDOMIM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 192.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|