C26H30N4O10 — CID 91306146
(4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-9-(propanoylcarbamoylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91306146) has the molecular formula C26H30N4O10 and a molecular weight of 558.54 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-9-(propanoylcarbamoylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-9-(propanoylcarbamoylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91306146 |
| Molecular Formula | C26H30N4O10 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-9-(propanoylcarbamoylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCC(=O)NC(=O)Nc1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]1[C@H]2C |
| InChI | InChI=1S/C26H30N4O10/c1-5-11(31)29-25(39)28-10-7-6-9-8(2)12-14(19(33)13(9)18(10)32)22(36)26(40)16(20(12)34)17(30(3)4)21(35)15(23(26)37)24(27)38/h6-8,12,14-17,20,32,34,40H,5H2,1-4H3,(H2,27,38)(H2,28,29,31,39)/t8-,12+,14?,15?,16+,17-,20-,26-/m0/s1 |
| InChIKey | MODAEIYOSCRXHY-HOWJZYRCSA-N |
| XLogP | -1.54 |
| TPSA | 233.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|