C27H33N3O9 — CID 91236973
[4-[(5R,5aR,6S,6aR,10aS)-9-carbamoyl-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]-4-methylpentyl] carbamimidate (PubChem CID 91236973) has the molecular formula C27H33N3O9 and a molecular weight of 543.57 g/mol. Its IUPAC name is [4-[(5R,5aR,6S,6aR,10aS)-9-carbamoyl-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]-4-methylpentyl] carbamimidate.
| Compound Name | [4-[(5R,5aR,6S,6aR,10aS)-9-carbamoyl-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]-4-methylpentyl] carbamimidate |
|---|---|
| PubChem CID | 91236973 |
| Molecular Formula | C27H33N3O9 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | [4-[(5R,5aR,6S,6aR,10aS)-9-carbamoyl-1,6,10a-trihydroxy-5-methyl-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]-4-methylpentyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCCCC(C)(C)c1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]1[C@H]2C |
| InChI | InChI=1S/C27H33N3O9/c1-10-11-5-6-12(26(2,3)7-4-8-39-25(29)30)19(32)16(11)21(34)18-15(10)20(33)13-9-14(31)17(24(28)37)22(35)27(13,38)23(18)36/h5-6,10,13,15,17-18,20,32-33,38H,4,7-9H2,1-3H3,(H2,28,37)(H3,29,30)/t10-,13+,15+,17?,18?,20+,27+/m0/s1 |
| InChIKey | AMLCPLBGDNXPMZ-XBJXRIHMSA-N |
| XLogP | -0.17 |
| TPSA | 231.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|