C27H30O9 — CID 91579241
(4aR,5S,5aR,6R,12aS)-9-tert-butyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-5-(2-oxopropyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxylic acid (PubChem CID 91579241) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-9-tert-butyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-5-(2-oxopropyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxylic acid.
| Compound Name | (4aR,5S,5aR,6R,12aS)-9-tert-butyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-5-(2-oxopropyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 91579241 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-9-tert-butyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-5-(2-oxopropyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxylic acid |
| SMILES | CC(=O)C[C@H]1[C@H]2C(C(=O)c3c(ccc(C(C)(C)C)c3O)[C@@H]2C)C(=O)[C@]2(O)C(=O)C(C(=O)O)C(=O)C[C@H]12 |
| InChI | InChI=1S/C27H30O9/c1-10(28)8-13-15-9-16(29)19(25(34)35)23(32)27(15,36)24(33)20-17(13)11(2)12-6-7-14(26(3,4)5)21(30)18(12)22(20)31/h6-7,11,13,15,17,19-20,30,36H,8-9H2,1-5H3,(H,34,35)/t11-,13+,15+,17-,19?,20?,27+/m0/s1 |
| InChIKey | RRUDKMIXXVZBBD-GOPHUVIESA-N |
| XLogP | 1.99 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|