C33H41NO9 — CID 90889752
[(4aR,5S,5aR,6R,12aS)-9-tert-butyl-2-(cyclopentylmethylcarbamoyl)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate (PubChem CID 90889752) has the molecular formula C33H41NO9 and a molecular weight of 595.69 g/mol. Its IUPAC name is [(4aR,5S,5aR,6R,12aS)-9-tert-butyl-2-(cyclopentylmethylcarbamoyl)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate.
| Compound Name | [(4aR,5S,5aR,6R,12aS)-9-tert-butyl-2-(cyclopentylmethylcarbamoyl)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 90889752 |
| Molecular Formula | C33H41NO9 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | [(4aR,5S,5aR,6R,12aS)-9-tert-butyl-2-(cyclopentylmethylcarbamoyl)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H]2C(C(=O)c3c(ccc(C(C)(C)C)c3O)[C@@H]2C)C(=O)[C@]2(O)C(=O)C(C(=O)NCC3CCCC3)C(=O)C[C@H]12 |
| InChI | InChI=1S/C33H41NO9/c1-6-21(36)43-28-19-13-20(35)24(31(41)34-14-16-9-7-8-10-16)29(39)33(19,42)30(40)25-22(28)15(2)17-11-12-18(32(3,4)5)26(37)23(17)27(25)38/h11-12,15-16,19,22,24-25,28,37,42H,6-10,13-14H2,1-5H3,(H,34,41)/t15-,19+,22+,24?,25?,28+,33+/m0/s1 |
| InChIKey | POENVJZAZDXLHX-CLARGHEASA-N |
| XLogP | 2.94 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|