C28H22ClF3N2O9 — CID 90725056
[(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] N-[4-chloro-2-(trifluoromethyl)phenyl]carbamate (PubChem CID 90725056) has the molecular formula C28H22ClF3N2O9 and a molecular weight of 622.94 g/mol. Its IUPAC name is [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] N-[4-chloro-2-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] N-[4-chloro-2-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 90725056 |
| Molecular Formula | C28H22ClF3N2O9 |
| Molecular Weight | 622.94 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] N-[4-chloro-2-(trifluoromethyl)phenyl]carbamate |
| SMILES | C[C@H]1c2cccc(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](OC(=O)Nc3ccc(Cl)cc3C(F)(F)F)[C@@H]21 |
| InChI | InChI=1S/C28H22ClF3N2O9/c1-9-11-3-2-4-15(35)18(11)21(37)20-17(9)22(13-8-16(36)19(25(33)40)23(38)27(13,42)24(20)39)43-26(41)34-14-6-5-10(29)7-12(14)28(30,31)32/h2-7,9,13,17,19-20,22,35,42H,8H2,1H3,(H2,33,40)(H,34,41)/t9-,13+,17+,19?,20?,22+,27+/m0/s1 |
| InChIKey | LXLYLWFJCVKAKD-JVKQOZBQSA-N |
| XLogP | 2.79 |
| TPSA | 190.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.94 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|