C34H43NO8 — CID 91522868
(4aR,5S,5aR,6R,12aS)-9-tert-butyl-N-(cyclopentylmethyl)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-5-(2-oxobutyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91522868) has the molecular formula C34H43NO8 and a molecular weight of 593.72 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-9-tert-butyl-N-(cyclopentylmethyl)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-5-(2-oxobutyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-9-tert-butyl-N-(cyclopentylmethyl)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-5-(2-oxobutyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91522868 |
| Molecular Formula | C34H43NO8 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-9-tert-butyl-N-(cyclopentylmethyl)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-5-(2-oxobutyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCC(=O)C[C@H]1[C@H]2C(C(=O)c3c(ccc(C(C)(C)C)c3O)[C@@H]2C)C(=O)[C@]2(O)C(=O)C(C(=O)NCC3CCCC3)C(=O)C[C@H]12 |
| InChI | InChI=1S/C34H43NO8/c1-6-18(36)13-20-22-14-23(37)26(32(42)35-15-17-9-7-8-10-17)30(40)34(22,43)31(41)27-24(20)16(2)19-11-12-21(33(3,4)5)28(38)25(19)29(27)39/h11-12,16-17,20,22,24,26-27,38,43H,6-10,13-15H2,1-5H3,(H,35,42)/t16-,20+,22+,24-,26?,27?,34+/m0/s1 |
| InChIKey | WOIWUJMDIJTYEU-WVZLABHYSA-N |
| XLogP | 3.60 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|