C25H29NO8 — CID 90760874
(4aR,5S,5aR,12aS)-5,10,12a-trihydroxy-N-(2-methylpentan-2-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90760874) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is (4aR,5S,5aR,12aS)-5,10,12a-trihydroxy-N-(2-methylpentan-2-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,12aS)-5,10,12a-trihydroxy-N-(2-methylpentan-2-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90760874 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (4aR,5S,5aR,12aS)-5,10,12a-trihydroxy-N-(2-methylpentan-2-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCC(C)(C)NC(=O)C1C(=O)C[C@@H]2[C@@H](O)[C@@H]3Cc4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C25H29NO8/c1-4-8-24(2,3)26-23(33)18-15(28)10-13-19(29)12-9-11-6-5-7-14(27)16(11)20(30)17(12)21(31)25(13,34)22(18)32/h5-7,12-13,17-19,27,29,34H,4,8-10H2,1-3H3,(H,26,33)/t12-,13-,17?,18?,19+,25+/m1/s1 |
| InChIKey | AXLZDBAZRJZJKN-CDHGCCABSA-N |
| XLogP | 0.51 |
| TPSA | 158.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|