C28H25NO9 — CID 123471713
(6Z)-6-[(4-ethoxyphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 123471713) has the molecular formula C28H25NO9 and a molecular weight of 519.51 g/mol. Its IUPAC name is (6Z)-6-[(4-ethoxyphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (6Z)-6-[(4-ethoxyphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 123471713 |
| Molecular Formula | C28H25NO9 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (6Z)-6-[(4-ethoxyphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCOc1ccc(/C=C2\c3cccc(O)c3C(=O)C3C(=O)C4(O)C(=O)C(C(N)=O)C(=O)CC4C(O)C23)cc1 |
| InChI | InChI=1S/C28H25NO9/c1-2-38-13-8-6-12(7-9-13)10-15-14-4-3-5-17(30)19(14)24(33)22-20(15)23(32)16-11-18(31)21(27(29)36)25(34)28(16,37)26(22)35/h3-10,16,20-23,30,32,37H,2,11H2,1H3,(H2,29,36)/b15-10+ |
| InChIKey | KBNDVRSBPJLJET-XNTDXEJSSA-N |
| XLogP | 0.69 |
| TPSA | 181.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|