C30H29NO8 — CID 91348034
6-[(4-tert-butylphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91348034) has the molecular formula C30H29NO8 and a molecular weight of 531.56 g/mol. Its IUPAC name is 6-[(4-tert-butylphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 6-[(4-tert-butylphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91348034 |
| Molecular Formula | C30H29NO8 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 6-[(4-tert-butylphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(C=C2c3cccc(O)c3C(=O)C3C(=O)C4(O)C(=O)C(C(N)=O)C(=O)CC4C(O)C23)cc1 |
| InChI | InChI=1S/C30H29NO8/c1-29(2,3)14-9-7-13(8-10-14)11-16-15-5-4-6-18(32)20(15)25(35)23-21(16)24(34)17-12-19(33)22(28(31)38)26(36)30(17,39)27(23)37/h4-11,17,21-24,32,34,39H,12H2,1-3H3,(H2,31,38) |
| InChIKey | BTDMOLDTXJTKOB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|