C30H28N2O10 — CID 91051509
methyl 4-[[(5aS,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-6,6a,7,11a-tetrahydro-5aH-tetracen-5-ylidene]methyl]benzoate (PubChem CID 91051509) has the molecular formula C30H28N2O10 and a molecular weight of 576.56 g/mol. Its IUPAC name is methyl 4-[[(5aS,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-6,6a,7,11a-tetrahydro-5aH-tetracen-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[(5aS,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-6,6a,7,11a-tetrahydro-5aH-tetracen-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 91051509 |
| Molecular Formula | C30H28N2O10 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | methyl 4-[[(5aS,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-6,6a,7,11a-tetrahydro-5aH-tetracen-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2c3cccc(O)c3C(=O)C3C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]4[C@@H](O)[C@H]23)cc1 |
| InChI | InChI=1S/C30H28N2O10/c1-32(2)22-21-24(35)18-15(11-12-7-9-13(10-8-12)29(40)42-3)14-5-4-6-16(33)17(14)23(34)19(18)26(37)30(21,41)27(38)20(25(22)36)28(31)39/h4-11,18-22,24,33,35,41H,1-3H3,(H2,31,39)/t18-,19?,20?,21-,22+,24+,30+/m1/s1 |
| InChIKey | PUCBYHKUSBVFTP-KOPDWQSOSA-N |
| XLogP | -0.38 |
| TPSA | 201.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|