C30H30N2O8 — CID 91560411
(4S,4aR,5S,5aS,12aS)-4-(dimethylamino)-6-[(3,5-dimethylphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91560411) has the molecular formula C30H30N2O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is (4S,4aR,5S,5aS,12aS)-4-(dimethylamino)-6-[(3,5-dimethylphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aS,12aS)-4-(dimethylamino)-6-[(3,5-dimethylphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91560411 |
| Molecular Formula | C30H30N2O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (4S,4aR,5S,5aS,12aS)-4-(dimethylamino)-6-[(3,5-dimethylphenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1cc(C)cc(C=C2c3cccc(O)c3C(=O)C3C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]4[C@@H](O)[C@H]23)c1 |
| InChI | InChI=1S/C30H30N2O8/c1-12-8-13(2)10-14(9-12)11-16-15-6-5-7-17(33)18(15)24(34)20-19(16)25(35)22-23(32(3)4)26(36)21(29(31)39)28(38)30(22,40)27(20)37/h5-11,19-23,25,33,35,40H,1-4H3,(H2,31,39)/t19-,20?,21?,22-,23+,25+,30+/m1/s1 |
| InChIKey | MCRBDFJZFCUPEH-UFJZBJRQSA-N |
| XLogP | 0.45 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|