C29H26N2O10 — CID 91515713
(4S,4aR,5S,5aS,12aS)-6-(1,3-benzodioxol-5-ylmethylidene)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91515713) has the molecular formula C29H26N2O10 and a molecular weight of 562.53 g/mol. Its IUPAC name is (4S,4aR,5S,5aS,12aS)-6-(1,3-benzodioxol-5-ylmethylidene)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aS,12aS)-6-(1,3-benzodioxol-5-ylmethylidene)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91515713 |
| Molecular Formula | C29H26N2O10 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | (4S,4aR,5S,5aS,12aS)-6-(1,3-benzodioxol-5-ylmethylidene)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)cccc4C(=Cc4ccc5c(c4)OCO5)[C@H]3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C29H26N2O10/c1-31(2)22-21-24(34)18-13(8-11-6-7-15-16(9-11)41-10-40-15)12-4-3-5-14(32)17(12)23(33)19(18)26(36)29(21,39)27(37)20(25(22)35)28(30)38/h3-9,18-22,24,32,34,39H,10H2,1-2H3,(H2,30,38)/t18-,19?,20?,21-,22+,24+,29+/m1/s1 |
| InChIKey | IJCGGVQKCIGRKW-SRMYRTQESA-N |
| XLogP | -0.44 |
| TPSA | 193.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|