C27H21NO10 — CID 91308345
(4aR,5S,5aS,12aS)-6-(1,3-benzodioxol-5-ylmethylidene)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91308345) has the molecular formula C27H21NO10 and a molecular weight of 519.46 g/mol. Its IUPAC name is (4aR,5S,5aS,12aS)-6-(1,3-benzodioxol-5-ylmethylidene)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aS,12aS)-6-(1,3-benzodioxol-5-ylmethylidene)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91308345 |
| Molecular Formula | C27H21NO10 |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | (4aR,5S,5aS,12aS)-6-(1,3-benzodioxol-5-ylmethylidene)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2[C@@H](O)[C@@H]3C(=Cc4ccc5c(c4)OCO5)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C27H21NO10/c28-26(35)20-15(30)8-13-22(31)19-12(6-10-4-5-16-17(7-10)38-9-37-16)11-2-1-3-14(29)18(11)23(32)21(19)25(34)27(13,36)24(20)33/h1-7,13,19-22,29,31,36H,8-9H2,(H2,28,35)/t13-,19-,20?,21?,22-,27-/m1/s1 |
| InChIKey | OLRABGBUPFSMDJ-RNGDTJKRSA-N |
| XLogP | 0.02 |
| TPSA | 190.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|