C29H26O8 — CID 123549363
(6Z)-2-acetyl-5,10,12a-trihydroxy-6-[(4-methoxyphenyl)methylidene]-3-methyl-4a,5,5a,11a-tetrahydro-4H-tetracene-1,11,12-trione (PubChem CID 123549363) has the molecular formula C29H26O8 and a molecular weight of 502.52 g/mol. Its IUPAC name is (6Z)-2-acetyl-5,10,12a-trihydroxy-6-[(4-methoxyphenyl)methylidene]-3-methyl-4a,5,5a,11a-tetrahydro-4H-tetracene-1,11,12-trione.
| Compound Name | (6Z)-2-acetyl-5,10,12a-trihydroxy-6-[(4-methoxyphenyl)methylidene]-3-methyl-4a,5,5a,11a-tetrahydro-4H-tetracene-1,11,12-trione |
|---|---|
| PubChem CID | 123549363 |
| Molecular Formula | C29H26O8 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (6Z)-2-acetyl-5,10,12a-trihydroxy-6-[(4-methoxyphenyl)methylidene]-3-methyl-4a,5,5a,11a-tetrahydro-4H-tetracene-1,11,12-trione |
| SMILES | COc1ccc(/C=C2\c3cccc(O)c3C(=O)C3C(=O)C4(O)C(=O)C(C(C)=O)=C(C)CC4C(O)C23)cc1 |
| InChI | InChI=1S/C29H26O8/c1-13-11-19-25(32)23-18(12-15-7-9-16(37-3)10-8-15)17-5-4-6-20(31)22(17)26(33)24(23)28(35)29(19,36)27(34)21(13)14(2)30/h4-10,12,19,23-25,31-32,36H,11H2,1-3H3/b18-12+ |
| InChIKey | HDUSBDCJWZLQPA-LDADJPATSA-N |
| XLogP | 2.54 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|