C26H19F2NO8 — CID 91474476
6-[(2,4-difluorophenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91474476) has the molecular formula C26H19F2NO8 and a molecular weight of 511.43 g/mol. Its IUPAC name is 6-[(2,4-difluorophenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 6-[(2,4-difluorophenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91474476 |
| Molecular Formula | C26H19F2NO8 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 6-[(2,4-difluorophenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)CC2C(O)C3C(=Cc4ccc(F)cc4F)c4cccc(O)c4C(=O)C3C(=O)C2(O)C1=O |
| InChI | InChI=1S/C26H19F2NO8/c27-10-5-4-9(14(28)7-10)6-12-11-2-1-3-15(30)17(11)22(33)20-18(12)21(32)13-8-16(31)19(25(29)36)23(34)26(13,37)24(20)35/h1-7,13,18-21,30,32,37H,8H2,(H2,29,36) |
| InChIKey | XJLYONBDZJQGDZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|