C26H20ClNO8 — CID 90822783
6-[(2-chlorophenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 90822783) has the molecular formula C26H20ClNO8 and a molecular weight of 509.90 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 6-[(2-chlorophenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90822783 |
| Molecular Formula | C26H20ClNO8 |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 6-[(2-chlorophenyl)methylidene]-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)CC2C(O)C3C(=Cc4ccccc4Cl)c4cccc(O)c4C(=O)C3C(=O)C2(O)C1=O |
| InChI | InChI=1S/C26H20ClNO8/c27-14-6-2-1-4-10(14)8-12-11-5-3-7-15(29)17(11)22(32)20-18(12)21(31)13-9-16(30)19(25(28)35)23(33)26(13,36)24(20)34/h1-8,13,18-21,29,31,36H,9H2,(H2,28,35) |
| InChIKey | LZHSHCAYEWJGOL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|