C26H21NO8 — CID 123747784
(6Z)-6-benzylidene-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 123747784) has the molecular formula C26H21NO8 and a molecular weight of 475.45 g/mol. Its IUPAC name is (6Z)-6-benzylidene-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (6Z)-6-benzylidene-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 123747784 |
| Molecular Formula | C26H21NO8 |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (6Z)-6-benzylidene-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)CC2C(O)C3/C(=C/c4ccccc4)c4cccc(O)c4C(=O)C3C(=O)C2(O)C1=O |
| InChI | InChI=1S/C26H21NO8/c27-25(34)19-16(29)10-14-21(30)18-13(9-11-5-2-1-3-6-11)12-7-4-8-15(28)17(12)22(31)20(18)24(33)26(14,35)23(19)32/h1-9,14,18-21,28,30,35H,10H2,(H2,27,34)/b13-9+ |
| InChIKey | VLVJRJFJAXLFMU-UKTHLTGXSA-N |
| XLogP | 0.30 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|