C21H17NO8 — CID 91016813
(4aR,5S,5aS,12aS)-5-formyl-10,12a-dihydroxy-6-methylidene-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91016813) has the molecular formula C21H17NO8 and a molecular weight of 411.37 g/mol. Its IUPAC name is (4aR,5S,5aS,12aS)-5-formyl-10,12a-dihydroxy-6-methylidene-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aS,12aS)-5-formyl-10,12a-dihydroxy-6-methylidene-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91016813 |
| Molecular Formula | C21H17NO8 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (4aR,5S,5aS,12aS)-5-formyl-10,12a-dihydroxy-6-methylidene-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C=C1c2cccc(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](C=O)[C@H]12 |
| InChI | InChI=1S/C21H17NO8/c1-7-8-3-2-4-11(24)14(8)17(26)16-13(7)9(6-23)10-5-12(25)15(20(22)29)18(27)21(10,30)19(16)28/h2-4,6,9-10,13,15-16,24,30H,1,5H2,(H2,22,29)/t9-,10-,13+,15?,16?,21-/m1/s1 |
| InChIKey | YFYSAJLFYKVFQC-COZKHRDGSA-N |
| XLogP | -0.78 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|