C25H27NO9 — CID 90875487
[(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] 3-methylbutanoate (PubChem CID 90875487) has the molecular formula C25H27NO9 and a molecular weight of 485.49 g/mol. Its IUPAC name is [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] 3-methylbutanoate.
| Compound Name | [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 90875487 |
| Molecular Formula | C25H27NO9 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)O[C@H]1[C@H]2C(C(=O)c3c(O)cccc3[C@@H]2C)C(=O)[C@]2(O)C(=O)C(C(N)=O)C(=O)C[C@H]12 |
| InChI | InChI=1S/C25H27NO9/c1-9(2)7-15(29)35-21-12-8-14(28)18(24(26)33)22(31)25(12,34)23(32)19-16(21)10(3)11-5-4-6-13(27)17(11)20(19)30/h4-6,9-10,12,16,18-19,21,27,34H,7-8H2,1-3H3,(H2,26,33)/t10-,12+,16+,18?,19?,21+,25+/m0/s1 |
| InChIKey | LPWNHDLEESZCSP-AUYXAQPGSA-N |
| XLogP | 0.46 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|