C29H35NO9 — CID 91461798
[(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-(5-methylhexyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate (PubChem CID 91461798) has the molecular formula C29H35NO9 and a molecular weight of 541.60 g/mol. Its IUPAC name is [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-(5-methylhexyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate.
| Compound Name | [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-(5-methylhexyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 91461798 |
| Molecular Formula | C29H35NO9 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | [(4aR,5S,5aR,6R,12aS)-2-carbamoyl-10,12a-dihydroxy-6-(5-methylhexyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H]2C(C(=O)c3c(O)cccc3[C@@H]2CCCCC(C)C)C(=O)[C@]2(O)C(=O)C(C(N)=O)C(=O)C[C@H]12 |
| InChI | InChI=1S/C29H35NO9/c1-4-19(33)39-25-16-12-18(32)22(28(30)37)26(35)29(16,38)27(36)23-21(25)15(9-6-5-8-13(2)3)14-10-7-11-17(31)20(14)24(23)34/h7,10-11,13,15-16,21-23,25,31,38H,4-6,8-9,12H2,1-3H3,(H2,30,37)/t15-,16+,21+,22?,23?,25+,29+/m0/s1 |
| InChIKey | XYEGGRCYFMQHFU-UDBJKANZSA-N |
| XLogP | 2.02 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|