C34H42N2O10 — CID 123184900
[2-carbamoyl-6-(cyclopentyloxymethyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] cyclohexanecarboxylate (PubChem CID 123184900) has the molecular formula C34H42N2O10 and a molecular weight of 638.71 g/mol. Its IUPAC name is [2-carbamoyl-6-(cyclopentyloxymethyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] cyclohexanecarboxylate.
| Compound Name | [2-carbamoyl-6-(cyclopentyloxymethyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 123184900 |
| Molecular Formula | C34H42N2O10 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | [2-carbamoyl-6-(cyclopentyloxymethyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] cyclohexanecarboxylate |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)cccc4C(COC4CCCC4)C3C(OC(=O)C3CCCCC3)C12 |
| InChI | InChI=1S/C34H42N2O10/c1-36(2)26-25-29(46-33(43)16-9-4-3-5-10-16)22-19(15-45-17-11-6-7-12-17)18-13-8-14-20(37)21(18)27(38)23(22)30(40)34(25,44)31(41)24(28(26)39)32(35)42/h8,13-14,16-17,19,22-26,29,37,44H,3-7,9-12,15H2,1-2H3,(H2,35,42) |
| InChIKey | JKUWWRDFRSVLGX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 190.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|