C28H32N2O9 — CID 123173061
6-(2-cyclopentyl-2-oxoethyl)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123173061) has the molecular formula C28H32N2O9 and a molecular weight of 540.57 g/mol. Its IUPAC name is 6-(2-cyclopentyl-2-oxoethyl)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 6-(2-cyclopentyl-2-oxoethyl)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123173061 |
| Molecular Formula | C28H32N2O9 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 6-(2-cyclopentyl-2-oxoethyl)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)cccc4C(CC(=O)C4CCCC4)C3C(O)C12 |
| InChI | InChI=1S/C28H32N2O9/c1-30(2)21-20-23(34)17-13(10-15(32)11-6-3-4-7-11)12-8-5-9-14(31)16(12)22(33)18(17)25(36)28(20,39)26(37)19(24(21)35)27(29)38/h5,8-9,11,13,17-21,23,31,34,39H,3-4,6-7,10H2,1-2H3,(H2,29,38) |
| InChIKey | KMZCRTBYSLAINE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 192.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|