C29H30N2O9 — CID 91602980
(4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(2-phenylethoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91602980) has the molecular formula C29H30N2O9 and a molecular weight of 550.56 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(2-phenylethoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(2-phenylethoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91602980 |
| Molecular Formula | C29H30N2O9 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(2-phenylethoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)cccc4[C@H](OCCc4ccccc4)[C@H]3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C29H30N2O9/c1-31(2)21-20-23(34)17-18(26(36)29(20,39)27(37)19(24(21)35)28(30)38)22(33)16-14(9-6-10-15(16)32)25(17)40-12-11-13-7-4-3-5-8-13/h3-10,17-21,23,25,32,34,39H,11-12H2,1-2H3,(H2,30,38)/t17-,18?,19?,20-,21+,23+,25+,29+/m1/s1 |
| InChIKey | RNUFQUUOYFHQRC-OXNNQBIBSA-N |
| XLogP | -0.40 |
| TPSA | 184.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|