C23H24N2O10 — CID 91188952
methyl (5S,5aS,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-5-carboxylate (PubChem CID 91188952) has the molecular formula C23H24N2O10 and a molecular weight of 488.45 g/mol. Its IUPAC name is methyl (5S,5aS,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-5-carboxylate.
| Compound Name | methyl (5S,5aS,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-5-carboxylate |
|---|---|
| PubChem CID | 91188952 |
| Molecular Formula | C23H24N2O10 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | methyl (5S,5aS,6S,6aR,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-5-carboxylate |
| SMILES | COC(=O)[C@@H]1c2cccc(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C23H24N2O10/c1-25(2)15-14-17(28)11-10(22(33)35-3)7-5-4-6-8(26)9(7)16(27)12(11)19(30)23(14,34)20(31)13(18(15)29)21(24)32/h4-6,10-15,17,26,28,34H,1-3H3,(H2,24,32)/t10-,11-,12?,13?,14-,15+,17+,23+/m1/s1 |
| InChIKey | IVCGCAXXLKGWID-MXRVRINPSA-N |
| XLogP | -2.45 |
| TPSA | 201.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|