C28H26F2N2O8 — CID 123468352
6-[(2,4-difluorophenyl)methyl]-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123468352) has the molecular formula C28H26F2N2O8 and a molecular weight of 556.52 g/mol. Its IUPAC name is 6-[(2,4-difluorophenyl)methyl]-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 6-[(2,4-difluorophenyl)methyl]-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123468352 |
| Molecular Formula | C28H26F2N2O8 |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 6-[(2,4-difluorophenyl)methyl]-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)cccc4C(Cc4ccc(F)cc4F)C3C(O)C12 |
| InChI | InChI=1S/C28H26F2N2O8/c1-32(2)21-20-23(35)17-13(8-10-6-7-11(29)9-14(10)30)12-4-3-5-15(33)16(12)22(34)18(17)25(37)28(20,40)26(38)19(24(21)36)27(31)39/h3-7,9,13,17-21,23,33,35,40H,8H2,1-2H3,(H2,31,39) |
| InChIKey | BYWDHEFNCYHIIW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|