C28H36N2O9 — CID 91395628
(4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-6-(hexoxymethyl)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91395628) has the molecular formula C28H36N2O9 and a molecular weight of 544.60 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-6-(hexoxymethyl)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-6-(hexoxymethyl)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91395628 |
| Molecular Formula | C28H36N2O9 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | (4R,4aS,5R,5aS,6S,12aR)-4-(dimethylamino)-6-(hexoxymethyl)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCCCCOC[C@@H]1c2cccc(O)c2C(=O)C2C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]3[C@H](O)[C@H]21 |
| InChI | InChI=1S/C28H36N2O9/c1-4-5-6-7-11-39-12-14-13-9-8-10-15(31)16(13)22(32)18-17(14)23(33)20-21(30(2)3)24(34)19(27(29)37)26(36)28(20,38)25(18)35/h8-10,14,17-21,23,31,33,38H,4-7,11-12H2,1-3H3,(H2,29,37)/t14-,17+,18?,19?,20+,21-,23-,28-/m1/s1 |
| InChIKey | GUWUIQNUCLAEHA-DJIQLHRISA-N |
| XLogP | -0.02 |
| TPSA | 184.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|