C26H32N2O8 — CID 91511362
(4R,4aS,5R,5aS,12aR)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-7-pentyl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91511362) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,12aR)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-7-pentyl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,12aR)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-7-pentyl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91511362 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (4R,4aS,5R,5aS,12aR)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-7-pentyl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCCCc1ccc(O)c2c1C[C@H]1C(C2=O)C(=O)[C@@]2(O)C(=O)C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]2[C@@H]1O |
| InChI | InChI=1S/C26H32N2O8/c1-4-5-6-7-11-8-9-14(29)15-12(11)10-13-16(21(15)31)23(33)26(36)18(20(13)30)19(28(2)3)22(32)17(24(26)34)25(27)35/h8-9,13,16-20,29-30,36H,4-7,10H2,1-3H3,(H2,27,35)/t13-,16?,17?,18-,19+,20+,26+/m0/s1 |
| InChIKey | YPYKJGZGJMGBTL-IMGARADOSA-N |
| XLogP | -0.43 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|