C23H27N3O8 — CID 56960237
(4S,4aR,5R,5aR,12aS)-4,7-bis(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 56960237) has the molecular formula C23H27N3O8 and a molecular weight of 473.48 g/mol. Its IUPAC name is (4S,4aR,5R,5aR,12aS)-4,7-bis(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5R,5aR,12aS)-4,7-bis(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 56960237 |
| Molecular Formula | C23H27N3O8 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (4S,4aR,5R,5aR,12aS)-4,7-bis(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(O)c2c1C[C@@H]1C(C2=O)C(=O)[C@]2(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C23H27N3O8/c1-25(2)10-5-6-11(27)12-8(10)7-9-13(18(12)29)20(31)23(34)15(17(9)28)16(26(3)4)19(30)14(21(23)32)22(24)33/h5-6,9,13-17,27-28,34H,7H2,1-4H3,(H2,24,33)/t9-,13?,14?,15-,16+,17-,23+/m1/s1 |
| InChIKey | VVBRLUOSBUXFGD-PPUSMUDGSA-N |
| XLogP | -2.10 |
| TPSA | 178.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|