C23H24N2O10 — CID 91367004
methyl (6S,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-carboxylate (PubChem CID 91367004) has the molecular formula C23H24N2O10 and a molecular weight of 488.45 g/mol. Its IUPAC name is methyl (6S,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-carboxylate.
| Compound Name | methyl (6S,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-carboxylate |
|---|---|
| PubChem CID | 91367004 |
| Molecular Formula | C23H24N2O10 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | methyl (6S,7S,10aS)-9-carbamoyl-7-(dimethylamino)-1,6,10a-trihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C1C2 |
| InChI | InChI=1S/C23H24N2O10/c1-25(2)14-13-16(27)9-6-7-4-5-8(22(33)35-3)15(26)10(7)17(28)11(9)19(30)23(13,34)20(31)12(18(14)29)21(24)32/h4-5,9,11-14,16,26-27,34H,6H2,1-3H3,(H2,24,32)/t9?,11?,12?,13?,14-,16?,23-/m0/s1 |
| InChIKey | SJJIWCIBAQIZRF-LEZGSSBMSA-N |
| XLogP | -2.38 |
| TPSA | 201.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|