C31H38N2O8 — CID 90987238
(4aR,5S,5aR,6R,12aS)-6-(2-cyclopentylethyl)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-9-prop-1-en-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90987238) has the molecular formula C31H38N2O8 and a molecular weight of 566.65 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-6-(2-cyclopentylethyl)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-9-prop-1-en-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-6-(2-cyclopentylethyl)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-9-prop-1-en-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90987238 |
| Molecular Formula | C31H38N2O8 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-6-(2-cyclopentylethyl)-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-9-prop-1-en-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C=C(C)c1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)[C@@H]3[C@@H](O)[C@@H]1[C@H]2CCC1CCCC1 |
| InChI | InChI=1S/C31H38N2O8/c1-13(2)15-11-12-17-16(10-9-14-7-5-6-8-14)18-20(25(35)19(17)24(15)34)28(38)31(41)22(26(18)36)23(33(3)4)27(37)21(29(31)39)30(32)40/h11-12,14,16,18,20-23,26,34,36,41H,1,5-10H2,2-4H3,(H2,32,40)/t16-,18+,20?,21?,22+,23?,26-,31-/m0/s1 |
| InChIKey | DSNZPHYNEDQLMA-GVVVSVGASA-N |
| XLogP | 1.38 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|