C25H33N5O7 — CID 56959081
(4S,4aS,5S,5aR,12aS)-9-amino-4,5,7-tris(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 56959081) has the molecular formula C25H33N5O7 and a molecular weight of 515.57 g/mol. Its IUPAC name is (4S,4aS,5S,5aR,12aS)-9-amino-4,5,7-tris(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5S,5aR,12aS)-9-amino-4,5,7-tris(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 56959081 |
| Molecular Formula | C25H33N5O7 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (4S,4aS,5S,5aR,12aS)-9-amino-4,5,7-tris(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(N)c(O)c2c1C[C@@H]1C(C2=O)C(=O)[C@]2(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]2[C@H]1N(C)C |
| InChI | InChI=1S/C25H33N5O7/c1-28(2)12-8-11(26)19(31)13-9(12)7-10-14(20(13)32)22(34)25(37)16(17(10)29(3)4)18(30(5)6)21(33)15(23(25)35)24(27)36/h8,10,14-18,31,37H,7,26H2,1-6H3,(H2,27,36)/t10-,14?,15?,16+,17+,18+,25+/m1/s1 |
| InChIKey | WSHQYMHWXFHLBT-MLUQDREESA-N |
| XLogP | -1.94 |
| TPSA | 187.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|