C29H25NO8 — CID 118951990
(6Z)-6-[(3-acetylphenyl)methylidene]-5,10,11,12a-tetrahydroxy-3-methyl-1,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 118951990) has the molecular formula C29H25NO8 and a molecular weight of 515.52 g/mol. Its IUPAC name is (6Z)-6-[(3-acetylphenyl)methylidene]-5,10,11,12a-tetrahydroxy-3-methyl-1,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (6Z)-6-[(3-acetylphenyl)methylidene]-5,10,11,12a-tetrahydroxy-3-methyl-1,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 118951990 |
| Molecular Formula | C29H25NO8 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | (6Z)-6-[(3-acetylphenyl)methylidene]-5,10,11,12a-tetrahydroxy-3-methyl-1,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CC(=O)c1cccc(/C=C2\c3cccc(O)c3C(O)=C3C(=O)C4(O)C(=O)C(C(N)=O)=C(C)CC4C(O)C32)c1 |
| InChI | InChI=1S/C29H25NO8/c1-12-9-18-24(33)22-17(11-14-5-3-6-15(10-14)13(2)31)16-7-4-8-19(32)21(16)25(34)23(22)27(36)29(18,38)26(35)20(12)28(30)37/h3-8,10-11,18,22,24,32-34,38H,9H2,1-2H3,(H2,30,37)/b17-11+ |
| InChIKey | JATAGQTXHSMKCV-GZTJUZNOSA-N |
| XLogP | 2.10 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|