C29H25F3N2O8 — CID 137475398
(4R,4aS,5S,5aR,6Z,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[[4-(trifluoromethyl)phenyl]methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 137475398) has the molecular formula C29H25F3N2O8 and a molecular weight of 586.52 g/mol. Its IUPAC name is (4R,4aS,5S,5aR,6Z,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[[4-(trifluoromethyl)phenyl]methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5S,5aR,6Z,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[[4-(trifluoromethyl)phenyl]methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 137475398 |
| Molecular Formula | C29H25F3N2O8 |
| Molecular Weight | 586.52 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | (4R,4aS,5S,5aR,6Z,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[[4-(trifluoromethyl)phenyl]methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4ccc(C(F)(F)F)cc4)[C@H]3[C@H](O)[C@H]12 |
| InChI | InChI=1S/C29H25F3N2O8/c1-34(2)21-20-23(37)17-14(10-11-6-8-12(9-7-11)29(30,31)32)13-4-3-5-15(35)16(13)22(36)18(17)25(39)28(20,42)26(40)19(24(21)38)27(33)41/h3-10,17,20-21,23,35-37,40,42H,1-2H3,(H2,33,41)/b14-10+/t17-,20+,21-,23+,28+/m1/s1 |
| InChIKey | FXXPQHXJHJYOPP-KNVHPABRSA-N |
| XLogP | 1.95 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|